1. PowerPoint Jeopardy Organic Chemistry

3. CH3CH2CH2CH2CH2CH2CH3 A-A1

4. heptane Q-A1

5. CH3C(CH3)2CH2CH3 A-A2

6. 2,2-dimethylbutane Q-A2

7. CH2=CHCH(CH3)CH(CH3)2 A-A3

8. 3,4-dimethyl-1-pentene Q-A3

9. CH3CH(CH3)CH(CH2CH3)C(CH3)3 A-A4

10. 3-ethyl-2,2,4-trimethylpentane Q-A4

11. (CH3CH2)2CHCH=CHCH3 A-A5

12. 4-ethyl-2-hexene Q-A5

13. HCHO A-B1

14. methanalor Formaldehyde Q-B1

15. CH3(CH2)4CH(OH)CH2CH3 A-B2

16. octanol Q-B2

17. Name: CH3C(CH3)2CH2COOH A-B3

18. 3,3-dimethyl-butanoic acid Q-B3

19. Name: CH3COOCH2CH2CH2CH3 A-B4

20. Butyl ethanoate Q-B4

21. (C6H5)CH2C(O)CH3 A-B5

22. 1-Phenyl-2-propanone Q-B5

23. The hybridization on the carbon atoms in the ethene molecule H2C=CH2 is A- C1

24. sp2 Q-C1

25. All of the following are structural isomers of C6H14 except a) CH3(CH2)4CH3b) CH3CH2C(CH3)3c) (CH3)2CHCH(CH3)2d) (CH3)2CHCH2CH3 A-C2

26. d) (CH3)2CHCH2CH3 Q-C2

27. Double Name and Draw all structural isomers are there for the molecular formula C5H12 A-C3

28. 2-methyl-butane 2,2-dimethyl-propane Q-C3

29. Which of the following compounds exist as geometric isomers (i.e., have cis and trans isomers)? 1. CH2=C(CH3)(CH2CH3) 2. CH3CH=CH(CH2CH3) 3. ClCH=C(CH3)2 4. ClCH=C(Cl)(CH3) A-C4

30. 2 and 4 Q-C4

31. Which of the following have optical isomers? • CH3CH2C(Br)(Cl)CH2CH3 • CH3COCH2CH3 • CH3CH(Br)CH2CH3 • CH3CH(CH3)CH2CH3 A-C5

32. 3. Q-C5

33. The compound CH3CH2OCH2CH3 is A-D1

34. Ether Q-D1

35. What are the building blocks of carbohydrates? A-D2

36. monosaccharides Q-D2

37. Starch and cellulose are A-D3

38. polysaccharides Q-D3

39. What is the oxidation number of carbon in the following? a) methane, CH4 b) methanol, CH3OH c) formaldehyde, HCHO d) formic acid, HCOOH A-D4

40. a) methane, CH4 -4b) methanol, CH3OH -2c) formaldehyde, HCHO 0d) formic acid, HCOOH +2 Q-D4

41. Show an example of a peptide bond A-D5

42. Q-D5

43. What is the general formula for saturated hydrocarbons? A-E1

44. CnH2n+2 Q-E1

45. Which of the following is not a proper name of an isomer of dimethylbenzene (xylene)? a) 1,2-dimethylbenzene b) 1,4-dimethylbenzene c) 1,5-dimethylbenzene d) 1,3-dimethylbenzene A-E2

46. c) 1,5-dimethylbenzene Q-E2

47. How many structural isomers of C3H8O? A-E3

48. 3 Q-E3

49. Type answer here What are the functional groups? A-E4

50. Aspirin: Carboxylic AcidEsterTylenol: alcohol Amide Q-E4